Faculté des sciences

New Dinuclear Ru2(CO)4 Sawhorse-Type Complexes Containing Bridging Carboxylato Ligands

Auzias, Mathieu ; Mattsson, Johan ; Therrien, Bruno ; Süss-Fink, Georg

In: Zeitschrift für anorganische und allgemeine Chemie, 2008, vol. 635, no. 1, p. 115-119

The thermal reaction of Ru3(CO)12 with ethacrynic acid, 4-[bis(2-chlorethyl)amino]benzenebutanoic acid (chlorambucil), or 4-phenylbutyric acid in refluxing solvents, followed by addition of two-electron donor ligands (L), gives the diruthenium complexes Ru2 (CO)4(O2CR)2L2 (1: R =... Plus

Ajouter à la liste personnelle
    Summary
    The thermal reaction of Ru3(CO)12 with ethacrynic acid, 4-[bis(2-chlorethyl)amino]benzenebutanoic acid (chlorambucil), or 4-phenylbutyric acid in refluxing solvents, followed by addition of two-electron donor ligands (L), gives the diruthenium complexes Ru2 (CO)4(O2CR)2L2 (1: R = CH2O-C6H2Cl2-COC(CH2)C2H5, L = C5H5N; 2: R = CH2O-C6H2Cl2-COC(CH2)C2H5, L = PPh3; 3: R = C3H6-C6H4-N(C2H4-Cl)2, L = C5H5N; 4: R = C3H6-C6H4-N(C2H4-Cl)2, L = PPh3; 5: R = C3H6-C6H5, L = C5H5N; 6: R = C3H6-C6H5, L = PPh3). The single-crystal structure analyses of 2, 3, 5 and 6 reveal a dinuclear Ru2(CO)4 sawhorse structure, the diruthenium backbone being bridged by the carboxylato ligands, while the two L ligands occupy the axial positions of the diruthenium unit.